![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[TXT]](/icons/text.gif) | structure-eng.htm | 2019-05-30 12:21 | 6.6K | |
| Your mailbox is almost full_.htm | 2020-07-09 22:54 | 4.9K | |
| Your mailbox is almost full_ (7).htm | 2020-07-01 19:48 | 4.9K | |
| Your mailbox is almost full_ (6).htm | 2020-07-03 21:25 | 4.9K | |
| Your mailbox is almost full_ (5).htm | 2020-07-04 21:39 | 4.9K | |
| Your mailbox is almost full_ (4).htm | 2020-07-05 21:44 | 4.9K | |
| Your mailbox is almost full_ (3).htm | 2020-07-06 22:01 | 4.9K | |
| Your mailbox is almost full_ (2).htm | 2020-07-07 22:18 | 4.9K | |
| Your mailbox is almost full_ (1).htm | 2020-07-08 22:45 | 4.9K | |
| What's happening at C Can.htm | 2020-07-09 16:15 | 34K | |
| What's happening at C Can (1).htm | 2020-07-07 14:16 | 34K | |
| Webinar Invitation 9 July 11 00 CET - COVID-19 and Long-Term Care Challenges, Responses and Future Planning.htm | 2020-07-07 11:25 | 47K | |
| Visa for Turkmenistan.htm | 2019-03-25 22:38 | 8.7K | |
| Request to provide email addressees.htm | 2019-06-19 14:47 | 116K | |
| Re Boarding Passes.htm | 2019-04-08 10:43 | 7.4K | |
| RE HRC44 Trafficking in persons, especially women and children - zero draft.htm | 2020-07-08 12:35 | 104K | |
| RE GEO_WHO Advocacy and consensus building workshop_24-26 March 2019_Tbilisi Georgia_minimum PC requirements.htm | 2019-03-21 19:28 | 68K | |
| RE GEO_WHO Advocacy and consensus building workshop_24-26 March 2019_Tbilisi Georgia_minimum PC requirements (1).htm | 2019-03-21 15:30 | 48K | |
| RE კოორდინაციის სტრუქტურისა და მექანიზმების ოპტიმიზაციის საჭიროება.htm | 2019-05-06 14:17 | 68K | |
| Maia, you have 7 job changes, 98 new updates and 3 invitations waiting for you on LinkedIn.htm | 2020-07-08 07:00 | 32K | |
| Maia, please add me to your LinkedIn network.htm | 2020-07-06 15:37 | 25K | |
| Maia, please add me to your LinkedIn network (2).htm | 2020-07-05 07:50 | 25K | |
| Maia, please add me to your LinkedIn network (1).htm | 2020-07-05 09:30 | 25K | |
| Lela Daghelashvili sent a message to the conversation ზვიადისტები 💣❤_.htm | 2020-07-05 13:34 | 14K | |
| Irinka Tsomaia sent you a message_.htm | 2020-07-09 20:35 | 14K | |
| Ingredients South Asia, Digital Edition, July 1-15, 2020.htm | 2020-07-04 06:48 | 8.5K | |
| Fwd confirmation.htm | 2019-05-09 16:18 | 16K | |
| FW 6 თვის მივლინების ანგარიში.htm | 2019-06-28 16:03 | 32K | |
| FW.htm | 2020-07-09 11:51 | 46K | |
| FW უწყებათაშორისი შეხვედრა.htm | 2020-07-09 10:58 | 54K | |
| Delivery Status Notification (Failure).htm | 2020-07-06 18:15 | 15K | |
| Delivery Status Notification (Failure) (1).htm | 2020-07-01 21:32 | 15K | |
| Congratulate Fredrik Vannberg and 5___.htm | 2020-07-06 05:50 | 35K | |
![[DIR]](/icons/folder.gif) | Attachments/ | 2025-11-21 02:03 | - | |
| Ana Laitadze sent a message to your group conversation_.htm | 2020-07-09 18:24 | 14K | |
| ციფრული ბარათი.htm | 2020-07-07 18:01 | 9.9K | |
| საჭიროების წერილი გაჩეჩილაძის.htm | 2019-03-25 09:13 | 20K | |
| ვებ-სუპერფინში გაფართოებული ძებნის საშუალება - უკვე ანგარიშ-ფაქტურებშიც.htm | 2020-07-07 16:08 | 41K | |
|
|---|